C12H11FN4O4 — CID 8538196
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(tetrazol-1-yl)acetate (PubChem CID 8538196) has the molecular formula C12H11FN4O4 and a molecular weight of 294.24 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(tetrazol-1-yl)acetate.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(tetrazol-1-yl)acetate |
|---|---|
| PubChem CID | 8538196 |
| Molecular Formula | C12H11FN4O4 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(tetrazol-1-yl)acetate |
| SMILES | COc1ccc(C(=O)COC(=O)Cn2cnnn2)cc1F |
| InChI | InChI=1S/C12H11FN4O4/c1-20-11-3-2-8(4-9(11)13)10(18)6-21-12(19)5-17-7-14-15-16-17/h2-4,7H,5-6H2,1H3 |
| InChIKey | VOUVHCDKJQHHIN-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 96.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |