About 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate
7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate (PubChem CID 85386682) has the molecular formula C17H24O6
and a molecular weight of 324.37 g/mol. Its IUPAC name is 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate.
Molecular Properties
| Compound Name | 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate |
| PubChem CID | 85386682 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate |
| SMILES | COC(=O)C1C2CCCC23CCC(=O)C1(C(=O)OC(C)(C)C)O3 |
| InChI | InChI=1S/C17H24O6/c1-15(2,3)22-14(20)17-11(18)7-9-16(23-17)8-5-6-10(16)12(17)13(19)21-4/h10,12H,5-9H2,1-4H3 |
| InChIKey | YVTIUKORGAPUOC-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate?
The IUPAC name of 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate (CID 85386682) is 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate.
What is the SMILES notation for 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate?
The canonical SMILES for 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate is COC(=O)C1C2CCCC23CCC(=O)C1(C(=O)OC(C)(C)C)O3.
What is the InChIKey of 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate?
The InChIKey is YVTIUKORGAPUOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24O6/c1-15(2,3)22-14(20)17-11(18)7-9-16(23-17)8-5-6-10(16)12(17)13(19)21-4/h10,12H,5-9H2,1-4H3.
What are the key properties of 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate?
7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate has a molecular weight of 324.37 g/mol, XLogP of 1.79, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-tert-butyl 6-O-methyl 8-oxo-11-oxatricyclo[5.3.1.01,5]undecane-6,7-dicarboxylate is sourced from PubChem (CID 85386682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).