C15H18O3 — CID 85389848
3,7,12-trimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradeca-6,12-dien-8-one (PubChem CID 85389848) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3,7,12-trimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradeca-6,12-dien-8-one.
| Compound Name | 3,7,12-trimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradeca-6,12-dien-8-one |
|---|---|
| PubChem CID | 85389848 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3,7,12-trimethyl-2,9-dioxatetracyclo[9.3.0.01,3.06,10]tetradeca-6,12-dien-8-one |
| SMILES | CC1=CCC23OC2(C)CCC2=C(C)C(=O)OC2C13 |
| InChI | InChI=1S/C15H18O3/c1-8-4-7-15-11(8)12-10(9(2)13(16)17-12)5-6-14(15,3)18-15/h4,11-12H,5-7H2,1-3H3 |
| InChIKey | FBMFZUVWPCVTSM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|