C26H22F6NOP — CID 85392048
[2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane (PubChem CID 85392048) has the molecular formula C26H22F6NOP and a molecular weight of 509.43 g/mol. Its IUPAC name is [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane.
| Compound Name | [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane |
|---|---|
| PubChem CID | 85392048 |
| Molecular Formula | C26H22F6NOP |
| Molecular Weight | 509.43 g/mol |
| Exact Mass | 509.13 |
| IUPAC Name | [2-(4-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)phenyl]-bis[4-(trifluoromethyl)phenyl]phosphane |
| SMILES | CC(C)C1COC(c2ccccc2P(c2ccc(C(F)(F)F)cc2)c2ccc(C(F)(F)F)cc2)=N1 |
| InChI | InChI=1S/C26H22F6NOP/c1-16(2)22-15-34-24(33-22)21-5-3-4-6-23(21)35(19-11-7-17(8-12-19)25(27,28)29)20-13-9-18(10-14-20)26(30,31)32/h3-14,16,22H,15H2,1-2H3 |
| InChIKey | FQLXXNARSMBTIN-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.43 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|