About 1-(2,5-dimethoxyphenyl)-3-methylthiourea
1-(2,5-dimethoxyphenyl)-3-methylthiourea (PubChem CID 853980) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-methylthiourea.
Molecular Properties
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-methylthiourea |
| PubChem CID | 853980 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-methylthiourea |
| SMILES | CNC(=S)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C10H14N2O2S/c1-11-10(15)12-8-6-7(13-2)4-5-9(8)14-3/h4-6H,1-3H3,(H2,11,12,15) |
| InChIKey | JVBGNPPYXIWVPH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,5-dimethoxyphenyl)-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethoxyphenyl)-3-methylthiourea?
The IUPAC name of 1-(2,5-dimethoxyphenyl)-3-methylthiourea (CID 853980) is 1-(2,5-dimethoxyphenyl)-3-methylthiourea.
What is the SMILES notation for 1-(2,5-dimethoxyphenyl)-3-methylthiourea?
The canonical SMILES for 1-(2,5-dimethoxyphenyl)-3-methylthiourea is CNC(=S)Nc1cc(OC)ccc1OC.
What is the InChIKey of 1-(2,5-dimethoxyphenyl)-3-methylthiourea?
The InChIKey is JVBGNPPYXIWVPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-11-10(15)12-8-6-7(13-2)4-5-9(8)14-3/h4-6H,1-3H3,(H2,11,12,15).
What are the key properties of 1-(2,5-dimethoxyphenyl)-3-methylthiourea?
1-(2,5-dimethoxyphenyl)-3-methylthiourea has a molecular weight of 226.30 g/mol, XLogP of 1.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethoxyphenyl)-3-methylthiourea is sourced from PubChem (CID 853980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).