About 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one
9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one (PubChem CID 85398673) has the molecular formula C22H30O3
and a molecular weight of 342.48 g/mol. Its IUPAC name is 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one.
Molecular Properties
| Compound Name | 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one |
| PubChem CID | 85398673 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one |
| SMILES | CC(=CCCC1(C)C=Cc2cc(O)c(C)cc2O1)CC(=O)CC(C)C |
| InChI | InChI=1S/C22H30O3/c1-15(2)11-19(23)12-16(3)7-6-9-22(5)10-8-18-14-20(24)17(4)13-21(18)25-22/h7-8,10,13-15,24H,6,9,11-12H2,1-5H3 |
| InChIKey | AIFCJVAASWMODR-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one?
The IUPAC name of 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one (CID 85398673) is 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one.
What is the SMILES notation for 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one?
The canonical SMILES for 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one is CC(=CCCC1(C)C=Cc2cc(O)c(C)cc2O1)CC(=O)CC(C)C.
What is the InChIKey of 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one?
The InChIKey is AIFCJVAASWMODR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O3/c1-15(2)11-19(23)12-16(3)7-6-9-22(5)10-8-18-14-20(24)17(4)13-21(18)25-22/h7-8,10,13-15,24H,6,9,11-12H2,1-5H3.
What are the key properties of 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one?
9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one has a molecular weight of 342.48 g/mol, XLogP of 5.60, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(6-hydroxy-2,7-dimethylchromen-2-yl)-2,6-dimethylnon-6-en-4-one is sourced from PubChem (CID 85398673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).