About 2,3,4,5-tetrahydroxypentanal
2,3,4,5-tetrahydroxypentanal (PubChem CID 854) has the molecular formula C5H10O5
and a molecular weight of 150.13 g/mol. Its IUPAC name is 2,3,4,5-tetrahydroxypentanal.
Molecular Properties
| Compound Name | 2,3,4,5-tetrahydroxypentanal |
| PubChem CID | 854 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 2,3,4,5-tetrahydroxypentanal |
| SMILES | O=CC(O)C(O)C(O)CO |
| InChI | InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2 |
| InChIKey | PYMYPHUHKUWMLA-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,5-tetrahydroxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetrahydroxypentanal?
The IUPAC name of 2,3,4,5-tetrahydroxypentanal (CID 854) is 2,3,4,5-tetrahydroxypentanal.
What is the SMILES notation for 2,3,4,5-tetrahydroxypentanal?
The canonical SMILES for 2,3,4,5-tetrahydroxypentanal is O=CC(O)C(O)C(O)CO.
What is the InChIKey of 2,3,4,5-tetrahydroxypentanal?
The InChIKey is PYMYPHUHKUWMLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5/c6-1-3(8)5(10)4(9)2-7/h1,3-5,7-10H,2H2.
What are the key properties of 2,3,4,5-tetrahydroxypentanal?
2,3,4,5-tetrahydroxypentanal has a molecular weight of 150.13 g/mol, XLogP of -2.74, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetrahydroxypentanal is sourced from PubChem (CID 854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).