About 3-ethoxycyclohexa-3,5-diene-1,2-diol
3-ethoxycyclohexa-3,5-diene-1,2-diol (PubChem CID 85401008) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-ethoxycyclohexa-3,5-diene-1,2-diol.
Molecular Properties
| Compound Name | 3-ethoxycyclohexa-3,5-diene-1,2-diol |
| PubChem CID | 85401008 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 3-ethoxycyclohexa-3,5-diene-1,2-diol |
| SMILES | CCOC1=CC=CC(O)C1O |
| InChI | InChI=1S/C8H12O3/c1-2-11-7-5-3-4-6(9)8(7)10/h3-6,8-10H,2H2,1H3 |
| InChIKey | YIADIIBZZYSAHF-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethoxycyclohexa-3,5-diene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxycyclohexa-3,5-diene-1,2-diol?
The IUPAC name of 3-ethoxycyclohexa-3,5-diene-1,2-diol (CID 85401008) is 3-ethoxycyclohexa-3,5-diene-1,2-diol.
What is the SMILES notation for 3-ethoxycyclohexa-3,5-diene-1,2-diol?
The canonical SMILES for 3-ethoxycyclohexa-3,5-diene-1,2-diol is CCOC1=CC=CC(O)C1O.
What is the InChIKey of 3-ethoxycyclohexa-3,5-diene-1,2-diol?
The InChIKey is YIADIIBZZYSAHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-2-11-7-5-3-4-6(9)8(7)10/h3-6,8-10H,2H2,1H3.
What are the key properties of 3-ethoxycyclohexa-3,5-diene-1,2-diol?
3-ethoxycyclohexa-3,5-diene-1,2-diol has a molecular weight of 156.18 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxycyclohexa-3,5-diene-1,2-diol is sourced from PubChem (CID 85401008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).