C11H15NO2 — CID 854031
(2S)-1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine (PubChem CID 854031) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (2S)-1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine.
| Compound Name | (2S)-1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 854031 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2S)-1-(1,3-benzodioxol-5-yl)-N-methylpropan-2-amine |
| SMILES | CN[C@@H](C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15NO2/c1-8(12-2)5-9-3-4-10-11(6-9)14-7-13-10/h3-4,6,8,12H,5,7H2,1-2H3/t8-/m0/s1 |
| InChIKey | SHXWCVYOXRDMCX-QMMMGPOBSA-N |
| XLogP | 1.57 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |