About pyridine-2,6-dicarboxamide
pyridine-2,6-dicarboxamide (PubChem CID 854039) has the molecular formula C7H7N3O2
and a molecular weight of 165.15 g/mol. Its IUPAC name is pyridine-2,6-dicarboxamide.
Molecular Properties
| Compound Name | pyridine-2,6-dicarboxamide |
| PubChem CID | 854039 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | pyridine-2,6-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(N)=O)n1 |
| InChI | InChI=1S/C7H7N3O2/c8-6(11)4-2-1-3-5(10-4)7(9)12/h1-3H,(H2,8,11)(H2,9,12) |
| InChIKey | UUVCRNTVNKTNRK-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyridine-2,6-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-2,6-dicarboxamide?
The IUPAC name of pyridine-2,6-dicarboxamide (CID 854039) is pyridine-2,6-dicarboxamide.
What is the SMILES notation for pyridine-2,6-dicarboxamide?
The canonical SMILES for pyridine-2,6-dicarboxamide is NC(=O)c1cccc(C(N)=O)n1.
What is the InChIKey of pyridine-2,6-dicarboxamide?
The InChIKey is UUVCRNTVNKTNRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O2/c8-6(11)4-2-1-3-5(10-4)7(9)12/h1-3H,(H2,8,11)(H2,9,12).
What are the key properties of pyridine-2,6-dicarboxamide?
pyridine-2,6-dicarboxamide has a molecular weight of 165.15 g/mol, XLogP of -0.72, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-2,6-dicarboxamide is sourced from PubChem (CID 854039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).