C20H21FN2O6 — CID 8540552
[2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate (PubChem CID 8540552) has the molecular formula C20H21FN2O6 and a molecular weight of 404.39 g/mol. Its IUPAC name is [2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 8540552 |
| Molecular Formula | C20H21FN2O6 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | [2-[[2-(3-methoxyanilino)-2-oxoethyl]-methylamino]-2-oxoethyl] 3-fluoro-4-methoxybenzoate |
| SMILES | COc1cccc(NC(=O)CN(C)C(=O)COC(=O)c2ccc(OC)c(F)c2)c1 |
| InChI | InChI=1S/C20H21FN2O6/c1-23(11-18(24)22-14-5-4-6-15(10-14)27-2)19(25)12-29-20(26)13-7-8-17(28-3)16(21)9-13/h4-10H,11-12H2,1-3H3,(H,22,24) |
| InChIKey | GVLXNADLYVZDNK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |