C14H14O7 — CID 85405748
(4-hydroxy-4-methyl-5-oxooxolan-3-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate (PubChem CID 85405748) has the molecular formula C14H14O7 and a molecular weight of 294.26 g/mol. Its IUPAC name is (4-hydroxy-4-methyl-5-oxooxolan-3-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate.
| Compound Name | (4-hydroxy-4-methyl-5-oxooxolan-3-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 85405748 |
| Molecular Formula | C14H14O7 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | (4-hydroxy-4-methyl-5-oxooxolan-3-yl) 3-(3,4-dihydroxyphenyl)prop-2-enoate |
| SMILES | CC1(O)C(=O)OCC1OC(=O)C=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C14H14O7/c1-14(19)11(7-20-13(14)18)21-12(17)5-3-8-2-4-9(15)10(16)6-8/h2-6,11,15-16,19H,7H2,1H3 |
| InChIKey | OPURFTKJCNDEDB-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|