C26H36O11 — CID 85407343
(12,14-diacetyloxy-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-9-yl)methyl acetate (PubChem CID 85407343) has the molecular formula C26H36O11 and a molecular weight of 524.56 g/mol. Its IUPAC name is (12,14-diacetyloxy-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-9-yl)methyl acetate.
| Compound Name | (12,14-diacetyloxy-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-9-yl)methyl acetate |
|---|---|
| PubChem CID | 85407343 |
| Molecular Formula | C26H36O11 |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (12,14-diacetyloxy-2,3-dihydroxy-4,13,18-trimethyl-5-oxo-6,17-dioxatetracyclo[11.5.0.03,7.016,18]octadec-8-en-9-yl)methyl acetate |
| SMILES | CC(=O)OCC1=CC2OC(=O)C(C)C2(O)C(O)C2C3(C)OC3CC(OC(C)=O)C2(C)C(OC(C)=O)CC1 |
| InChI | InChI=1S/C26H36O11/c1-12-23(31)36-20-9-16(11-33-13(2)27)7-8-17(34-14(3)28)24(5)18(35-15(4)29)10-19-25(6,37-19)21(24)22(30)26(12,20)32/h9,12,17-22,30,32H,7-8,10-11H2,1-6H3 |
| InChIKey | SERDASPZBFBYJK-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|