C13H16F3N3O5S — CID 8540923
[2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 8540923) has the molecular formula C13H16F3N3O5S and a molecular weight of 383.35 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 8540923 |
| Molecular Formula | C13H16F3N3O5S |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylcarbamoylamino)ethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@]12CCC(=O)N1[C@@H](C(=O)OCC(=O)NC(=O)NCC(F)(F)F)CS2 |
| InChI | InChI=1S/C13H16F3N3O5S/c1-12-3-2-9(21)19(12)7(5-25-12)10(22)24-4-8(20)18-11(23)17-6-13(14,15)16/h7H,2-6H2,1H3,(H2,17,18,20,23)/t7-,12+/m1/s1 |
| InChIKey | VHYAHJJPLFBIGI-KRTXAFLBSA-N |
| XLogP | 0.37 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |