C20H30O10S2 — CID 85411083
4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-sulfooxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolane-3-sulfonic acid (PubChem CID 85411083) has the molecular formula C20H30O10S2 and a molecular weight of 494.58 g/mol. Its IUPAC name is 4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-sulfooxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolane-3-sulfonic acid.
| Compound Name | 4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-sulfooxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolane-3-sulfonic acid |
|---|---|
| PubChem CID | 85411083 |
| Molecular Formula | C20H30O10S2 |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 4-[2-[5-(hydroxymethyl)-5,8a-dimethyl-2-methylidene-6-sulfooxy-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl]ethylidene]-5-oxooxolane-3-sulfonic acid |
| SMILES | C=C1CCC2C(C)(CO)C(OS(=O)(=O)O)CCC2(C)C1CC=C1C(=O)OCC1S(=O)(=O)O |
| InChI | InChI=1S/C20H30O10S2/c1-12-4-7-16-19(2,9-8-17(20(16,3)11-21)30-32(26,27)28)14(12)6-5-13-15(31(23,24)25)10-29-18(13)22/h5,14-17,21H,1,4,6-11H2,2-3H3,(H,23,24,25)(H,26,27,28) |
| InChIKey | GIOODRZBWUVFLR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|