About N-buta-1,3-dienyl-N-propylacetamide
N-buta-1,3-dienyl-N-propylacetamide (PubChem CID 85412264) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-buta-1,3-dienyl-N-propylacetamide.
Molecular Properties
| Compound Name | N-buta-1,3-dienyl-N-propylacetamide |
| PubChem CID | 85412264 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-buta-1,3-dienyl-N-propylacetamide |
| SMILES | C=CC=CN(CCC)C(C)=O |
| InChI | InChI=1S/C9H15NO/c1-4-6-8-10(7-5-2)9(3)11/h4,6,8H,1,5,7H2,2-3H3 |
| InChIKey | DEENMSHTVOBFTM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-buta-1,3-dienyl-N-propylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-buta-1,3-dienyl-N-propylacetamide?
The IUPAC name of N-buta-1,3-dienyl-N-propylacetamide (CID 85412264) is N-buta-1,3-dienyl-N-propylacetamide.
What is the SMILES notation for N-buta-1,3-dienyl-N-propylacetamide?
The canonical SMILES for N-buta-1,3-dienyl-N-propylacetamide is C=CC=CN(CCC)C(C)=O.
What is the InChIKey of N-buta-1,3-dienyl-N-propylacetamide?
The InChIKey is DEENMSHTVOBFTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-6-8-10(7-5-2)9(3)11/h4,6,8H,1,5,7H2,2-3H3.
What are the key properties of N-buta-1,3-dienyl-N-propylacetamide?
N-buta-1,3-dienyl-N-propylacetamide has a molecular weight of 153.22 g/mol, XLogP of 1.94, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-buta-1,3-dienyl-N-propylacetamide is sourced from PubChem (CID 85412264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).