C19H23N2O3+ — CID 8541323
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-benzyl-ethylazanium (PubChem CID 8541323) has the molecular formula C19H23N2O3+ and a molecular weight of 327.40 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-benzyl-ethylazanium.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-benzyl-ethylazanium |
|---|---|
| PubChem CID | 8541323 |
| Molecular Formula | C19H23N2O3+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]-benzyl-ethylazanium |
| SMILES | CC[NH+](CC(=O)NCc1ccc2c(c1)OCO2)Cc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-2-21(12-15-6-4-3-5-7-15)13-19(22)20-11-16-8-9-17-18(10-16)24-14-23-17/h3-10H,2,11-14H2,1H3,(H,20,22)/p+1 |
| InChIKey | JWJLCXSJZRBDGN-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |