C19H25N5O4 — CID 8541570
N-(2-methoxyethyl)-2-[4-(3-methyl-4-oxophthalazine-1-carbonyl)piperazin-1-yl]acetamide (PubChem CID 8541570) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-[4-(3-methyl-4-oxophthalazine-1-carbonyl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-methoxyethyl)-2-[4-(3-methyl-4-oxophthalazine-1-carbonyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8541570 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | N-(2-methoxyethyl)-2-[4-(3-methyl-4-oxophthalazine-1-carbonyl)piperazin-1-yl]acetamide |
| SMILES | COCCNC(=O)CN1CCN(C(=O)c2nn(C)c(=O)c3ccccc23)CC1 |
| InChI | InChI=1S/C19H25N5O4/c1-22-18(26)15-6-4-3-5-14(15)17(21-22)19(27)24-10-8-23(9-11-24)13-16(25)20-7-12-28-2/h3-6H,7-13H2,1-2H3,(H,20,25) |
| InChIKey | AKTCRJQYDUCNKI-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 96.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|