C12H18O4 — CID 85416282
dimethyl 2-ethenylcyclohexane-1,1-dicarboxylate (PubChem CID 85416282) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is dimethyl 2-ethenylcyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-ethenylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 85416282 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | dimethyl 2-ethenylcyclohexane-1,1-dicarboxylate |
| SMILES | C=CC1CCCCC1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H18O4/c1-4-9-7-5-6-8-12(9,10(13)15-2)11(14)16-3/h4,9H,1,5-8H2,2-3H3 |
| InChIKey | DOOUNNGHGFDUSS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|