C23H28BrNO2 — CID 85418010
[2-(3-bromophenyl)cyclopropyl]-[4-[3-(diethylamino)propoxy]phenyl]methanone (PubChem CID 85418010) has the molecular formula C23H28BrNO2 and a molecular weight of 430.39 g/mol. Its IUPAC name is [2-(3-bromophenyl)cyclopropyl]-[4-[3-(diethylamino)propoxy]phenyl]methanone.
| Compound Name | [2-(3-bromophenyl)cyclopropyl]-[4-[3-(diethylamino)propoxy]phenyl]methanone |
|---|---|
| PubChem CID | 85418010 |
| Molecular Formula | C23H28BrNO2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [2-(3-bromophenyl)cyclopropyl]-[4-[3-(diethylamino)propoxy]phenyl]methanone |
| SMILES | CCN(CC)CCCOc1ccc(C(=O)C2CC2c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C23H28BrNO2/c1-3-25(4-2)13-6-14-27-20-11-9-17(10-12-20)23(26)22-16-21(22)18-7-5-8-19(24)15-18/h5,7-12,15,21-22H,3-4,6,13-14,16H2,1-2H3 |
| InChIKey | MJRSCQLFEOUVOM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|