About 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one
1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one (PubChem CID 85419929) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one.
Analyze 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one?
The IUPAC name of 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one (CID 85419929) is 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one.
What is the SMILES notation for 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one?
The canonical SMILES for 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one is CC1=CC(=O)C2CC(C)OC1(C)O2.
What is the InChIKey of 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one?
The InChIKey is ZNKUBHOIUUERAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-6-4-8(11)9-5-7(2)12-10(6,3)13-9/h4,7,9H,5H2,1-3H3.
What are the key properties of 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one?
1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one has a molecular weight of 182.22 g/mol, XLogP of 1.43, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,8-trimethyl-2,9-dioxabicyclo[3.3.1]non-7-en-6-one is sourced from PubChem (CID 85419929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).