About 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone
2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone (PubChem CID 85420041) has the molecular formula C10H16N2O3
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone.
Molecular Properties
| Compound Name | 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone |
| PubChem CID | 85420041 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone |
| SMILES | CCC1(C(=O)C=[N+]=[N-])OC(C)CC(C)O1 |
| InChI | InChI=1S/C10H16N2O3/c1-4-10(9(13)6-12-11)14-7(2)5-8(3)15-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | HUQQGXRPVVKHLI-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone?
The IUPAC name of 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone (CID 85420041) is 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone.
What is the SMILES notation for 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone?
The canonical SMILES for 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone is CCC1(C(=O)C=[N+]=[N-])OC(C)CC(C)O1.
What is the InChIKey of 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone?
The InChIKey is HUQQGXRPVVKHLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O3/c1-4-10(9(13)6-12-11)14-7(2)5-8(3)15-10/h6-8H,4-5H2,1-3H3.
What are the key properties of 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone?
2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone has a molecular weight of 212.25 g/mol, XLogP of 1.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-1-(2-ethyl-4,6-dimethyl-1,3-dioxan-2-yl)ethanone is sourced from PubChem (CID 85420041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).