C21H18N2O6 — CID 85421526
3-(4-diazo-3-oxobutyl)-1,6,8-trimethoxyanthracene-9,10-dione (PubChem CID 85421526) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is 3-(4-diazo-3-oxobutyl)-1,6,8-trimethoxyanthracene-9,10-dione.
| Compound Name | 3-(4-diazo-3-oxobutyl)-1,6,8-trimethoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 85421526 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-(4-diazo-3-oxobutyl)-1,6,8-trimethoxyanthracene-9,10-dione |
| SMILES | COc1cc(OC)c2c(c1)C(=O)c1cc(CCC(=O)C=[N+]=[N-])cc(OC)c1C2=O |
| InChI | InChI=1S/C21H18N2O6/c1-27-13-8-15-19(17(9-13)29-3)21(26)18-14(20(15)25)6-11(7-16(18)28-2)4-5-12(24)10-23-22/h6-10H,4-5H2,1-3H3 |
| InChIKey | PYUPSWRBJUGTEE-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 115.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|