C53H53N3O9S — CID 85423457
7-azido-2-phenyl-6-phenylsulfanyl-8-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 85423457) has the molecular formula C53H53N3O9S and a molecular weight of 908.09 g/mol. Its IUPAC name is 7-azido-2-phenyl-6-phenylsulfanyl-8-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | 7-azido-2-phenyl-6-phenylsulfanyl-8-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 85423457 |
| Molecular Formula | C53H53N3O9S |
| Molecular Weight | 908.09 g/mol |
| Exact Mass | 907.35 |
| IUPAC Name | 7-azido-2-phenyl-6-phenylsulfanyl-8-[3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | [N-]=[N+]=NC1C(Sc2ccccc2)OC2COC(c3ccccc3)OC2C1OC1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C53H53N3O9S/c54-56-55-45-48(47-44(63-53(45)66-42-29-17-6-18-30-42)36-61-51(64-47)41-27-15-5-16-28-41)65-52-50(60-34-40-25-13-4-14-26-40)49(59-33-39-23-11-3-12-24-39)46(58-32-38-21-9-2-10-22-38)43(62-52)35-57-31-37-19-7-1-8-20-37/h1-30,43-53H,31-36H2 |
| InChIKey | IRUOXUZAWQQFKH-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 131.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.09 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|