C16H21ClN4O4 — CID 8542443
2-(4-acetylpiperazin-1-yl)-N'-[2-(4-chlorophenoxy)acetyl]acetohydrazide (PubChem CID 8542443) has the molecular formula C16H21ClN4O4 and a molecular weight of 368.82 g/mol. Its IUPAC name is 2-(4-acetylpiperazin-1-yl)-N'-[2-(4-chlorophenoxy)acetyl]acetohydrazide.
| Compound Name | 2-(4-acetylpiperazin-1-yl)-N'-[2-(4-chlorophenoxy)acetyl]acetohydrazide |
|---|---|
| PubChem CID | 8542443 |
| Molecular Formula | C16H21ClN4O4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-(4-acetylpiperazin-1-yl)-N'-[2-(4-chlorophenoxy)acetyl]acetohydrazide |
| SMILES | CC(=O)N1CCN(CC(=O)NNC(=O)COc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H21ClN4O4/c1-12(22)21-8-6-20(7-9-21)10-15(23)18-19-16(24)11-25-14-4-2-13(17)3-5-14/h2-5H,6-11H2,1H3,(H,18,23)(H,19,24) |
| InChIKey | WPYUXNKBKTXMIE-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|