C12H17NO3 — CID 85427594
1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbaldehyde (PubChem CID 85427594) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbaldehyde.
| Compound Name | 1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbaldehyde |
|---|---|
| PubChem CID | 85427594 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carbaldehyde |
| SMILES | CC1(C=O)CC2(C)CC(C)(C1)C(=O)NC2=O |
| InChI | InChI=1S/C12H17NO3/c1-10(7-14)4-11(2)6-12(3,5-10)9(16)13-8(11)15/h7H,4-6H2,1-3H3,(H,13,15,16) |
| InChIKey | UTRZTXCHDFTIKW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|