About CID 85428122
CID 85428122 (PubChem CID 85428122) has the molecular formula C20H25Si
and a molecular weight of 293.51 g/mol.
Molecular Properties
| Compound Name | CID 85428122 |
| PubChem CID | 85428122 |
| Molecular Formula | C20H25Si |
| Molecular Weight | 293.51 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | — |
| SMILES | CCCC=C(CCC)[Si](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25Si/c1-3-5-13-18(12-4-2)21(19-14-8-6-9-15-19)20-16-10-7-11-17-20/h6-11,13-17H,3-5,12H2,1-2H3 |
| InChIKey | WTTYTMDXLDZWGX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 85428122 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 85428122?
The IUPAC name of CID 85428122 (CID 85428122) is not available.
What is the SMILES notation for CID 85428122?
The canonical SMILES for CID 85428122 is CCCC=C(CCC)[Si](c1ccccc1)c1ccccc1.
What is the InChIKey of CID 85428122?
The InChIKey is WTTYTMDXLDZWGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25Si/c1-3-5-13-18(12-4-2)21(19-14-8-6-9-15-19)20-16-10-7-11-17-20/h6-11,13-17H,3-5,12H2,1-2H3.
What are the key properties of CID 85428122?
CID 85428122 has a molecular weight of 293.51 g/mol, XLogP of 4.36, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 85428122 is sourced from PubChem (CID 85428122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).