C15H27N3O2 — CID 8543236
(3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidine-3-carboxamide (PubChem CID 8543236) has the molecular formula C15H27N3O2 and a molecular weight of 281.40 g/mol. Its IUPAC name is (3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 8543236 |
| Molecular Formula | C15H27N3O2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.21 |
| IUPAC Name | (3S)-1-[(2R)-1-(cyclohexylamino)-1-oxopropan-2-yl]piperidine-3-carboxamide |
| SMILES | C[C@H](C(=O)NC1CCCCC1)N1CCC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C15H27N3O2/c1-11(15(20)17-13-7-3-2-4-8-13)18-9-5-6-12(10-18)14(16)19/h11-13H,2-10H2,1H3,(H2,16,19)(H,17,20)/t11-,12+/m1/s1 |
| InChIKey | HUWHTURYGAOKDA-NEPJUHHUSA-N |
| XLogP | 1.02 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |