About ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate
ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate (PubChem CID 85432498) has the molecular formula C15H13F4N3O3
and a molecular weight of 359.28 g/mol. Its IUPAC name is ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate.
Molecular Properties
| Compound Name | ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate |
| PubChem CID | 85432498 |
| Molecular Formula | C15H13F4N3O3 |
| Molecular Weight | 359.28 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate |
| SMILES | CCOC(=O)C=C(C=NNc1cc(OC)c(C#N)cc1F)C(F)(F)F |
| InChI | InChI=1S/C15H13F4N3O3/c1-3-25-14(23)5-10(15(17,18)19)8-21-22-12-6-13(24-2)9(7-20)4-11(12)16/h4-6,8,22H,3H2,1-2H3 |
| InChIKey | JGJJCVDNQJHRMR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate?
The IUPAC name of ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate (CID 85432498) is ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate.
What is the SMILES notation for ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate?
The canonical SMILES for ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate is CCOC(=O)C=C(C=NNc1cc(OC)c(C#N)cc1F)C(F)(F)F.
What is the InChIKey of ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate?
The InChIKey is JGJJCVDNQJHRMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F4N3O3/c1-3-25-14(23)5-10(15(17,18)19)8-21-22-12-6-13(24-2)9(7-20)4-11(12)16/h4-6,8,22H,3H2,1-2H3.
What are the key properties of ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate?
ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate has a molecular weight of 359.28 g/mol, XLogP of 3.16, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[[(4-cyano-2-fluoro-5-methoxyphenyl)hydrazinylidene]methyl]-4,4,4-trifluorobut-2-enoate is sourced from PubChem (CID 85432498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).