C15H13NO6S — CID 85433484
methyl 2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate (PubChem CID 85433484) has the molecular formula C15H13NO6S and a molecular weight of 335.34 g/mol. Its IUPAC name is methyl 2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | methyl 2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 85433484 |
| Molecular Formula | C15H13NO6S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | methyl 2-[5-(1,3-benzodioxol-5-ylmethylidene)-2,4-dioxo-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COC(=O)C(C)N1C(=O)SC(=Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C15H13NO6S/c1-8(14(18)20-2)16-13(17)12(23-15(16)19)6-9-3-4-10-11(5-9)22-7-21-10/h3-6,8H,7H2,1-2H3 |
| InChIKey | BTQSERRDSQCVBZ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|