C24H33FO3 — CID 85435461
5-fluoro-6-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]octa-3,5-dien-2-one (PubChem CID 85435461) has the molecular formula C24H33FO3 and a molecular weight of 388.52 g/mol. Its IUPAC name is 5-fluoro-6-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]octa-3,5-dien-2-one.
| Compound Name | 5-fluoro-6-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]octa-3,5-dien-2-one |
|---|---|
| PubChem CID | 85435461 |
| Molecular Formula | C24H33FO3 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 5-fluoro-6-[3-(methoxymethoxy)-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]octa-3,5-dien-2-one |
| SMILES | CCC(=C(F)C=CC(C)=O)c1cc2c(cc1OCOC)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H33FO3/c1-8-17(21(25)10-9-16(2)26)18-13-19-20(14-22(18)28-15-27-7)24(5,6)12-11-23(19,3)4/h9-10,13-14H,8,11-12,15H2,1-7H3 |
| InChIKey | BFNAPSZYDZWHQJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|