About 6-chlorohex-2-enoyl chloride
6-chlorohex-2-enoyl chloride (PubChem CID 85435529) has the molecular formula C6H8Cl2O
and a molecular weight of 167.03 g/mol. Its IUPAC name is 6-chlorohex-2-enoyl chloride.
Molecular Properties
| Compound Name | 6-chlorohex-2-enoyl chloride |
| PubChem CID | 85435529 |
| Molecular Formula | C6H8Cl2O |
| Molecular Weight | 167.03 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | 6-chlorohex-2-enoyl chloride |
| SMILES | O=C(Cl)C=CCCCCl |
| InChI | InChI=1S/C6H8Cl2O/c7-5-3-1-2-4-6(8)9/h2,4H,1,3,5H2 |
| InChIKey | HWPPIJPRTBFBLC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.03 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorohex-2-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorohex-2-enoyl chloride?
The IUPAC name of 6-chlorohex-2-enoyl chloride (CID 85435529) is 6-chlorohex-2-enoyl chloride.
What is the SMILES notation for 6-chlorohex-2-enoyl chloride?
The canonical SMILES for 6-chlorohex-2-enoyl chloride is O=C(Cl)C=CCCCCl.
What is the InChIKey of 6-chlorohex-2-enoyl chloride?
The InChIKey is HWPPIJPRTBFBLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8Cl2O/c7-5-3-1-2-4-6(8)9/h2,4H,1,3,5H2.
What are the key properties of 6-chlorohex-2-enoyl chloride?
6-chlorohex-2-enoyl chloride has a molecular weight of 167.03 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorohex-2-enoyl chloride is sourced from PubChem (CID 85435529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).