About 3-bromo-3,4-dihydro-1,2,4-triazol-5-one
3-bromo-3,4-dihydro-1,2,4-triazol-5-one (PubChem CID 85435736) has the molecular formula C2H2BrN3O
and a molecular weight of 163.96 g/mol. Its IUPAC name is 3-bromo-3,4-dihydro-1,2,4-triazol-5-one.
Molecular Properties
| Compound Name | 3-bromo-3,4-dihydro-1,2,4-triazol-5-one |
| PubChem CID | 85435736 |
| Molecular Formula | C2H2BrN3O |
| Molecular Weight | 163.96 g/mol |
| Exact Mass | 162.94 |
| IUPAC Name | 3-bromo-3,4-dihydro-1,2,4-triazol-5-one |
| SMILES | O=C1N=NC(Br)N1 |
| InChI | InChI=1S/C2H2BrN3O/c3-1-4-2(7)6-5-1/h1H,(H,4,7) |
| InChIKey | CDOQNMLYTBALCA-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.96 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-3,4-dihydro-1,2,4-triazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-3,4-dihydro-1,2,4-triazol-5-one?
The IUPAC name of 3-bromo-3,4-dihydro-1,2,4-triazol-5-one (CID 85435736) is 3-bromo-3,4-dihydro-1,2,4-triazol-5-one.
What is the SMILES notation for 3-bromo-3,4-dihydro-1,2,4-triazol-5-one?
The canonical SMILES for 3-bromo-3,4-dihydro-1,2,4-triazol-5-one is O=C1N=NC(Br)N1.
What is the InChIKey of 3-bromo-3,4-dihydro-1,2,4-triazol-5-one?
The InChIKey is CDOQNMLYTBALCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H2BrN3O/c3-1-4-2(7)6-5-1/h1H,(H,4,7).
What are the key properties of 3-bromo-3,4-dihydro-1,2,4-triazol-5-one?
3-bromo-3,4-dihydro-1,2,4-triazol-5-one has a molecular weight of 163.96 g/mol, XLogP of 0.84, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-3,4-dihydro-1,2,4-triazol-5-one is sourced from PubChem (CID 85435736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).