C13H20O3 — CID 85435827
5-(methoxymethoxy)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one (PubChem CID 85435827) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 5-(methoxymethoxy)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one.
| Compound Name | 5-(methoxymethoxy)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
|---|---|
| PubChem CID | 85435827 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 5-(methoxymethoxy)-4a-methyl-3,4,5,6,7,8-hexahydronaphthalen-2-one |
| SMILES | COCOC1CCCC2=CC(=O)CCC21C |
| InChI | InChI=1S/C13H20O3/c1-13-7-6-11(14)8-10(13)4-3-5-12(13)16-9-15-2/h8,12H,3-7,9H2,1-2H3 |
| InChIKey | WAQWNRKKXKPQTC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|