About benzyl 1H-pyrrole-2-carboxylate
benzyl 1H-pyrrole-2-carboxylate (PubChem CID 8543774) has the molecular formula C12H11NO2
and a molecular weight of 201.23 g/mol. Its IUPAC name is benzyl 1H-pyrrole-2-carboxylate.
Molecular Properties
| Compound Name | benzyl 1H-pyrrole-2-carboxylate |
| PubChem CID | 8543774 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | benzyl 1H-pyrrole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1ccc[nH]1 |
| InChI | InChI=1S/C12H11NO2/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10/h1-8,13H,9H2 |
| InChIKey | XTKILPAAGBOZHY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzyl 1H-pyrrole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 1H-pyrrole-2-carboxylate?
The IUPAC name of benzyl 1H-pyrrole-2-carboxylate (CID 8543774) is benzyl 1H-pyrrole-2-carboxylate.
What is the SMILES notation for benzyl 1H-pyrrole-2-carboxylate?
The canonical SMILES for benzyl 1H-pyrrole-2-carboxylate is O=C(OCc1ccccc1)c1ccc[nH]1.
What is the InChIKey of benzyl 1H-pyrrole-2-carboxylate?
The InChIKey is XTKILPAAGBOZHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c14-12(11-7-4-8-13-11)15-9-10-5-2-1-3-6-10/h1-8,13H,9H2.
What are the key properties of benzyl 1H-pyrrole-2-carboxylate?
benzyl 1H-pyrrole-2-carboxylate has a molecular weight of 201.23 g/mol, XLogP of 2.37, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 1H-pyrrole-2-carboxylate is sourced from PubChem (CID 8543774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).