About 1,1-diethylthiourea
1,1-diethylthiourea (PubChem CID 854389) has the molecular formula C5H12N2S
and a molecular weight of 132.23 g/mol. Its IUPAC name is 1,1-diethylthiourea.
Molecular Properties
| Compound Name | 1,1-diethylthiourea |
| PubChem CID | 854389 |
| Molecular Formula | C5H12N2S |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.07 |
| IUPAC Name | 1,1-diethylthiourea |
| SMILES | CCN(CC)C(N)=S |
| InChI | InChI=1S/C5H12N2S/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3,(H2,6,8) |
| InChIKey | CNLHIRFQKMVKPX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethylthiourea?
The IUPAC name of 1,1-diethylthiourea (CID 854389) is 1,1-diethylthiourea.
What is the SMILES notation for 1,1-diethylthiourea?
The canonical SMILES for 1,1-diethylthiourea is CCN(CC)C(N)=S.
What is the InChIKey of 1,1-diethylthiourea?
The InChIKey is CNLHIRFQKMVKPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2S/c1-3-7(4-2)5(6)8/h3-4H2,1-2H3,(H2,6,8).
What are the key properties of 1,1-diethylthiourea?
1,1-diethylthiourea has a molecular weight of 132.23 g/mol, XLogP of 0.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethylthiourea is sourced from PubChem (CID 854389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).