About zinc;N,N-dimethylbut-3-yn-1-amine;ethane
zinc;N,N-dimethylbut-3-yn-1-amine;ethane (PubChem CID 85439298) has the molecular formula C8H15NZn
and a molecular weight of 190.60 g/mol. Its IUPAC name is zinc;N,N-dimethylbut-3-yn-1-amine;ethane.
Molecular Properties
| Compound Name | zinc;N,N-dimethylbut-3-yn-1-amine;ethane |
| PubChem CID | 85439298 |
| Molecular Formula | C8H15NZn |
| Molecular Weight | 190.60 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | zinc;N,N-dimethylbut-3-yn-1-amine;ethane |
| SMILES | [C-]#CCCN(C)C.[CH2-]C.[Zn+2] |
| InChI | InChI=1S/C6H10N.C2H5.Zn/c1-4-5-6-7(2)3;1-2;/h5-6H2,2-3H3;1H2,2H3;/q2*-1;+2 |
| InChIKey | UDBSFSJBJWGHKI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.60 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze zinc;N,N-dimethylbut-3-yn-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;N,N-dimethylbut-3-yn-1-amine;ethane?
The IUPAC name of zinc;N,N-dimethylbut-3-yn-1-amine;ethane (CID 85439298) is zinc;N,N-dimethylbut-3-yn-1-amine;ethane.
What is the SMILES notation for zinc;N,N-dimethylbut-3-yn-1-amine;ethane?
The canonical SMILES for zinc;N,N-dimethylbut-3-yn-1-amine;ethane is [C-]#CCCN(C)C.[CH2-]C.[Zn+2].
What is the InChIKey of zinc;N,N-dimethylbut-3-yn-1-amine;ethane?
The InChIKey is UDBSFSJBJWGHKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N.C2H5.Zn/c1-4-5-6-7(2)3;1-2;/h5-6H2,2-3H3;1H2,2H3;/q2*-1;+2.
What are the key properties of zinc;N,N-dimethylbut-3-yn-1-amine;ethane?
zinc;N,N-dimethylbut-3-yn-1-amine;ethane has a molecular weight of 190.60 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;N,N-dimethylbut-3-yn-1-amine;ethane is sourced from PubChem (CID 85439298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).