About butane;platinum(2+)
butane;platinum(2+) (PubChem CID 85439871) has the molecular formula C8H18Pt
and a molecular weight of 309.31 g/mol. Its IUPAC name is butane;platinum(2+).
Molecular Properties
| Compound Name | butane;platinum(2+) |
| PubChem CID | 85439871 |
| Molecular Formula | C8H18Pt |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | butane;platinum(2+) |
| SMILES | [CH2-]CCC.[CH2-]CCC.[Pt+2] |
| InChI | InChI=1S/2C4H9.Pt/c2*1-3-4-2;/h2*1,3-4H2,2H3;/q2*-1;+2 |
| InChIKey | DVTWIQCKEJGWCU-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze butane;platinum(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;platinum(2+)?
The IUPAC name of butane;platinum(2+) (CID 85439871) is butane;platinum(2+).
What is the SMILES notation for butane;platinum(2+)?
The canonical SMILES for butane;platinum(2+) is [CH2-]CCC.[CH2-]CCC.[Pt+2].
What is the InChIKey of butane;platinum(2+)?
The InChIKey is DVTWIQCKEJGWCU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H9.Pt/c2*1-3-4-2;/h2*1,3-4H2,2H3;/q2*-1;+2.
What are the key properties of butane;platinum(2+)?
butane;platinum(2+) has a molecular weight of 309.31 g/mol, XLogP of 3.24, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane;platinum(2+) is sourced from PubChem (CID 85439871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).