About 7-(dimethylamino)hepta-4,6-dien-3-one
7-(dimethylamino)hepta-4,6-dien-3-one (PubChem CID 85441702) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is 7-(dimethylamino)hepta-4,6-dien-3-one.
Molecular Properties
| Compound Name | 7-(dimethylamino)hepta-4,6-dien-3-one |
| PubChem CID | 85441702 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 7-(dimethylamino)hepta-4,6-dien-3-one |
| SMILES | CCC(=O)C=CC=CN(C)C |
| InChI | InChI=1S/C9H15NO/c1-4-9(11)7-5-6-8-10(2)3/h5-8H,4H2,1-3H3 |
| InChIKey | VERVVHILGVGNJC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-(dimethylamino)hepta-4,6-dien-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(dimethylamino)hepta-4,6-dien-3-one?
The IUPAC name of 7-(dimethylamino)hepta-4,6-dien-3-one (CID 85441702) is 7-(dimethylamino)hepta-4,6-dien-3-one.
What is the SMILES notation for 7-(dimethylamino)hepta-4,6-dien-3-one?
The canonical SMILES for 7-(dimethylamino)hepta-4,6-dien-3-one is CCC(=O)C=CC=CN(C)C.
What is the InChIKey of 7-(dimethylamino)hepta-4,6-dien-3-one?
The InChIKey is VERVVHILGVGNJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO/c1-4-9(11)7-5-6-8-10(2)3/h5-8H,4H2,1-3H3.
What are the key properties of 7-(dimethylamino)hepta-4,6-dien-3-one?
7-(dimethylamino)hepta-4,6-dien-3-one has a molecular weight of 153.22 g/mol, XLogP of 1.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(dimethylamino)hepta-4,6-dien-3-one is sourced from PubChem (CID 85441702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).