About 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate
1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate (PubChem CID 85444045) has the molecular formula C30H23BF4N2
and a molecular weight of 498.33 g/mol. Its IUPAC name is 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate.
Molecular Properties
| Compound Name | 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate |
| PubChem CID | 85444045 |
| Molecular Formula | C30H23BF4N2 |
| Molecular Weight | 498.33 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate |
| SMILES | C(=N[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)c1ccccc1.F[B-](F)(F)F |
| InChI | InChI=1S/C30H23N2.BF4/c1-5-13-24(14-6-1)23-31-32-29(26-17-9-3-10-18-26)21-28(25-15-7-2-8-16-25)22-30(32)27-19-11-4-12-20-27;2-1(3,4)5/h1-23H;/q+1;-1 |
| InChIKey | BIKDWJLIDCSQAX-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 16.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 498.33 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate?
The IUPAC name of 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate (CID 85444045) is 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate.
What is the SMILES notation for 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate?
The canonical SMILES for 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate is C(=N[n+]1c(-c2ccccc2)cc(-c2ccccc2)cc1-c1ccccc1)c1ccccc1.F[B-](F)(F)F.
What is the InChIKey of 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate?
The InChIKey is BIKDWJLIDCSQAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H23N2.BF4/c1-5-13-24(14-6-1)23-31-32-29(26-17-9-3-10-18-26)21-28(25-15-7-2-8-16-25)22-30(32)27-19-11-4-12-20-27;2-1(3,4)5/h1-23H;/q+1;-1.
What are the key properties of 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate?
1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate has a molecular weight of 498.33 g/mol, XLogP of 8.16, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-N-(2,4,6-triphenylpyridin-1-ium-1-yl)methanimine tetrafluoroborate is sourced from PubChem (CID 85444045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).