About methyl 6-chlorohex-2-enoate
methyl 6-chlorohex-2-enoate (PubChem CID 85444077) has the molecular formula C7H11ClO2
and a molecular weight of 162.62 g/mol. Its IUPAC name is methyl 6-chlorohex-2-enoate.
Molecular Properties
| Compound Name | methyl 6-chlorohex-2-enoate |
| PubChem CID | 85444077 |
| Molecular Formula | C7H11ClO2 |
| Molecular Weight | 162.62 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | methyl 6-chlorohex-2-enoate |
| SMILES | COC(=O)C=CCCCCl |
| InChI | InChI=1S/C7H11ClO2/c1-10-7(9)5-3-2-4-6-8/h3,5H,2,4,6H2,1H3 |
| InChIKey | KKTDRMSDCIROTM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.62 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-chlorohex-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chlorohex-2-enoate?
The IUPAC name of methyl 6-chlorohex-2-enoate (CID 85444077) is methyl 6-chlorohex-2-enoate.
What is the SMILES notation for methyl 6-chlorohex-2-enoate?
The canonical SMILES for methyl 6-chlorohex-2-enoate is COC(=O)C=CCCCCl.
What is the InChIKey of methyl 6-chlorohex-2-enoate?
The InChIKey is KKTDRMSDCIROTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClO2/c1-10-7(9)5-3-2-4-6-8/h3,5H,2,4,6H2,1H3.
What are the key properties of methyl 6-chlorohex-2-enoate?
methyl 6-chlorohex-2-enoate has a molecular weight of 162.62 g/mol, XLogP of 1.73, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chlorohex-2-enoate is sourced from PubChem (CID 85444077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).