C17H15Cl2N3O — CID 85446224
3,5-bis(2-chlorophenyl)-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine (PubChem CID 85446224) has the molecular formula C17H15Cl2N3O and a molecular weight of 348.23 g/mol. Its IUPAC name is 3,5-bis(2-chlorophenyl)-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine.
| Compound Name | 3,5-bis(2-chlorophenyl)-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine |
|---|---|
| PubChem CID | 85446224 |
| Molecular Formula | C17H15Cl2N3O |
| Molecular Weight | 348.23 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 3,5-bis(2-chlorophenyl)-5,6,7,8-tetrahydro-3H-[1,2,4]oxadiazolo[4,3-c]pyrimidine |
| SMILES | Clc1ccccc1C1NCCC2=NOC(c3ccccc3Cl)N21 |
| InChI | InChI=1S/C17H15Cl2N3O/c18-13-7-3-1-5-11(13)16-20-10-9-15-21-23-17(22(15)16)12-6-2-4-8-14(12)19/h1-8,16-17,20H,9-10H2 |
| InChIKey | ZWYJIBOQILTNIA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.23 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |