C11H10F2N2O2 — CID 85448287
1-[(2,6-difluorophenyl)methyl]-1,3-diazinane-2,4-dione (PubChem CID 85448287) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 85448287 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-1,3-diazinane-2,4-dione |
| SMILES | O=C1CCN(Cc2c(F)cccc2F)C(=O)N1 |
| InChI | InChI=1S/C11H10F2N2O2/c12-8-2-1-3-9(13)7(8)6-15-5-4-10(16)14-11(15)17/h1-3H,4-6H2,(H,14,16,17) |
| InChIKey | SMIRTVINDHDHTD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |