C14H13ClN2O3 — CID 8545630
[(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate (PubChem CID 8545630) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate.
| Compound Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 8545630 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | [(2R)-1-(3-chloroanilino)-1-oxopropan-2-yl] 1H-pyrrole-2-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc[nH]1)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-9(20-14(19)12-6-3-7-16-12)13(18)17-11-5-2-4-10(15)8-11/h2-9,16H,1H3,(H,17,18)/t9-/m1/s1 |
| InChIKey | RXLOGVVBUFKEPD-SECBINFHSA-N |
| XLogP | 2.85 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |