C20H24N2O3S — CID 85457192
1-acetyl-N-(4-phenylbutan-2-yl)-2,3-dihydroindole-5-sulfonamide (PubChem CID 85457192) has the molecular formula C20H24N2O3S and a molecular weight of 372.49 g/mol. Its IUPAC name is 1-acetyl-N-(4-phenylbutan-2-yl)-2,3-dihydroindole-5-sulfonamide.
| Compound Name | 1-acetyl-N-(4-phenylbutan-2-yl)-2,3-dihydroindole-5-sulfonamide |
|---|---|
| PubChem CID | 85457192 |
| Molecular Formula | C20H24N2O3S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 1-acetyl-N-(4-phenylbutan-2-yl)-2,3-dihydroindole-5-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(S(=O)(=O)NC(C)CCc3ccccc3)ccc21 |
| InChI | InChI=1S/C20H24N2O3S/c1-15(8-9-17-6-4-3-5-7-17)21-26(24,25)19-10-11-20-18(14-19)12-13-22(20)16(2)23/h3-7,10-11,14-15,21H,8-9,12-13H2,1-2H3 |
| InChIKey | RVPILZQKBPTAOV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |