About ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate
ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate (PubChem CID 8546587) has the molecular formula C17H18F2N2O4S2
and a molecular weight of 416.47 g/mol. Its IUPAC name is ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate |
| PubChem CID | 8546587 |
| Molecular Formula | C17H18F2N2O4S2 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(S[C@@H](C)C(=O)Nc2ccccc2OC(F)F)n1 |
| InChI | InChI=1S/C17H18F2N2O4S2/c1-3-24-14(22)8-11-9-26-17(20-11)27-10(2)15(23)21-12-6-4-5-7-13(12)25-16(18)19/h4-7,9-10,16H,3,8H2,1-2H3,(H,21,23)/t10-/m0/s1 |
| InChIKey | RYXFWAWUKKWAMP-JTQLQIEISA-N |
| XLogP | 3.97 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate?
The IUPAC name of ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate (CID 8546587) is ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate.
What is the SMILES notation for ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate?
The canonical SMILES for ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate is CCOC(=O)Cc1csc(S[C@@H](C)C(=O)Nc2ccccc2OC(F)F)n1.
What is the InChIKey of ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate?
The InChIKey is RYXFWAWUKKWAMP-JTQLQIEISA-N. The full InChI is InChI=1S/C17H18F2N2O4S2/c1-3-24-14(22)8-11-9-26-17(20-11)27-10(2)15(23)21-12-6-4-5-7-13(12)25-16(18)19/h4-7,9-10,16H,3,8H2,1-2H3,(H,21,23)/t10-/m0/s1.
What are the key properties of ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate?
ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate has a molecular weight of 416.47 g/mol, XLogP of 3.97, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[(2S)-1-[2-(difluoromethoxy)anilino]-1-oxopropan-2-yl]sulfanyl-1,3-thiazol-4-yl]acetate is sourced from PubChem (CID 8546587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).