C26H22F4N4O2 — CID 85469071
3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(piperidin-1-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid (PubChem CID 85469071) has the molecular formula C26H22F4N4O2 and a molecular weight of 498.48 g/mol. Its IUPAC name is 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(piperidin-1-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid.
| Compound Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(piperidin-1-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85469071 |
| Molecular Formula | C26H22F4N4O2 |
| Molecular Weight | 498.48 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 3-methyl-6-[2,3,5,6-tetrafluoro-4-[3-(piperidin-1-ylmethyl)phenyl]phenyl]benzotriazole-4-carboxylic acid |
| SMILES | Cn1nnc2cc(-c3c(F)c(F)c(-c4cccc(CN5CCCCC5)c4)c(F)c3F)cc(C(=O)O)c21 |
| InChI | InChI=1S/C26H22F4N4O2/c1-33-25-17(26(35)36)11-16(12-18(25)31-32-33)20-23(29)21(27)19(22(28)24(20)30)15-7-5-6-14(10-15)13-34-8-3-2-4-9-34/h5-7,10-12H,2-4,8-9,13H2,1H3,(H,35,36) |
| InChIKey | XMFQYAJQWOLOSK-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.48 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|