C23H18F4N4O2 — CID 85469127
6-[4-[3-[(dimethylamino)methyl]phenyl]-2,3,5,6-tetrafluorophenyl]-3-methylbenzotriazole-4-carboxylic acid (PubChem CID 85469127) has the molecular formula C23H18F4N4O2 and a molecular weight of 458.42 g/mol. Its IUPAC name is 6-[4-[3-[(dimethylamino)methyl]phenyl]-2,3,5,6-tetrafluorophenyl]-3-methylbenzotriazole-4-carboxylic acid.
| Compound Name | 6-[4-[3-[(dimethylamino)methyl]phenyl]-2,3,5,6-tetrafluorophenyl]-3-methylbenzotriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 85469127 |
| Molecular Formula | C23H18F4N4O2 |
| Molecular Weight | 458.42 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 6-[4-[3-[(dimethylamino)methyl]phenyl]-2,3,5,6-tetrafluorophenyl]-3-methylbenzotriazole-4-carboxylic acid |
| SMILES | CN(C)Cc1cccc(-c2c(F)c(F)c(-c3cc(C(=O)O)c4c(c3)nnn4C)c(F)c2F)c1 |
| InChI | InChI=1S/C23H18F4N4O2/c1-30(2)10-11-5-4-6-12(7-11)16-18(24)20(26)17(21(27)19(16)25)13-8-14(23(32)33)22-15(9-13)28-29-31(22)3/h4-9H,10H2,1-3H3,(H,32,33) |
| InChIKey | NCGJADVWXPGHFL-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|