About 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione
8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione (PubChem CID 85469243) has the molecular formula C19H15FN4O2
and a molecular weight of 350.35 g/mol. Its IUPAC name is 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione.
Molecular Properties
| Compound Name | 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione |
| PubChem CID | 85469243 |
| Molecular Formula | C19H15FN4O2 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione |
| SMILES | O=C1c2cc(F)ccc2-n2c1nc1ccc(N3CCNCC3)cc1c2=O |
| InChI | InChI=1S/C19H15FN4O2/c20-11-1-4-16-14(9-11)17(25)18-22-15-3-2-12(23-7-5-21-6-8-23)10-13(15)19(26)24(16)18/h1-4,9-10,21H,5-8H2 |
| InChIKey | RPUURHIUQGSCQG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione?
The IUPAC name of 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione (CID 85469243) is 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione.
What is the SMILES notation for 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione?
The canonical SMILES for 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione is O=C1c2cc(F)ccc2-n2c1nc1ccc(N3CCNCC3)cc1c2=O.
What is the InChIKey of 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione?
The InChIKey is RPUURHIUQGSCQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN4O2/c20-11-1-4-16-14(9-11)17(25)18-22-15-3-2-12(23-7-5-21-6-8-23)10-13(15)19(26)24(16)18/h1-4,9-10,21H,5-8H2.
What are the key properties of 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione?
8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione has a molecular weight of 350.35 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-2-piperazin-1-ylindolo[2,1-b]quinazoline-6,12-dione is sourced from PubChem (CID 85469243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).