C23H23ClF6N6O2S — CID 85469771
3-N-[3-chloro-5-(trifluoromethyl)-4-[4-[1-(3,3,3-trifluoropropyl)piperidin-3-yl]sulfonylphenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 85469771) has the molecular formula C23H23ClF6N6O2S and a molecular weight of 596.99 g/mol. Its IUPAC name is 3-N-[3-chloro-5-(trifluoromethyl)-4-[4-[1-(3,3,3-trifluoropropyl)piperidin-3-yl]sulfonylphenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[3-chloro-5-(trifluoromethyl)-4-[4-[1-(3,3,3-trifluoropropyl)piperidin-3-yl]sulfonylphenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 85469771 |
| Molecular Formula | C23H23ClF6N6O2S |
| Molecular Weight | 596.99 g/mol |
| Exact Mass | 596.12 |
| IUPAC Name | 3-N-[3-chloro-5-(trifluoromethyl)-4-[4-[1-(3,3,3-trifluoropropyl)piperidin-3-yl]sulfonylphenyl]phenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2cc(Cl)c(-c3ccc(S(=O)(=O)C4CCCN(CCC(F)(F)F)C4)cc3)c(C(F)(F)F)c2)n[nH]1 |
| InChI | InChI=1S/C23H23ClF6N6O2S/c24-18-11-14(32-21-33-20(31)34-35-21)10-17(23(28,29)30)19(18)13-3-5-15(6-4-13)39(37,38)16-2-1-8-36(12-16)9-7-22(25,26)27/h3-6,10-11,16H,1-2,7-9,12H2,(H4,31,32,33,34,35) |
| InChIKey | VRWAQSBGNSRHKQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.99 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |